C18H21N2O7P — CID 56649062
propan-2-yl (2S)-2-[[(2-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 56649062) has the molecular formula C18H21N2O7P and a molecular weight of 408.35 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 56649062 |
| Molecular Formula | C18H21N2O7P |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(Oc1ccccc1)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N2O7P/c1-13(2)25-18(21)14(3)19-28(24,26-15-9-5-4-6-10-15)27-17-12-8-7-11-16(17)20(22)23/h4-14H,1-3H3,(H,19,24)/t14-,28?/m0/s1 |
| InChIKey | QLXAPSAQXILSKM-DCXKMBIZSA-N |
| XLogP | 4.09 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|