C13H20NO4P — CID 58463507
propan-2-yl (2S)-2-[[methyl(phenoxy)phosphoryl]amino]propanoate (PubChem CID 58463507) has the molecular formula C13H20NO4P and a molecular weight of 285.28 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[methyl(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[methyl(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58463507 |
| Molecular Formula | C13H20NO4P |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | propan-2-yl (2S)-2-[[methyl(phenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(C)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H20NO4P/c1-10(2)17-13(15)11(3)14-19(4,16)18-12-8-6-5-7-9-12/h5-11H,1-4H3,(H,14,16)/t11-,19?/m0/s1 |
| InChIKey | BMWLMKWXWGIGHC-IFGYVTRGSA-N |
| XLogP | 2.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|