C20H26NO4P — CID 123446714
propan-2-yl 2-[[methyl-[4-(4-methylphenyl)phenoxy]phosphoryl]amino]propanoate (PubChem CID 123446714) has the molecular formula C20H26NO4P and a molecular weight of 375.41 g/mol. Its IUPAC name is propan-2-yl 2-[[methyl-[4-(4-methylphenyl)phenoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[methyl-[4-(4-methylphenyl)phenoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123446714 |
| Molecular Formula | C20H26NO4P |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | propan-2-yl 2-[[methyl-[4-(4-methylphenyl)phenoxy]phosphoryl]amino]propanoate |
| SMILES | Cc1ccc(-c2ccc(OP(C)(=O)NC(C)C(=O)OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26NO4P/c1-14(2)24-20(22)16(4)21-26(5,23)25-19-12-10-18(11-13-19)17-8-6-15(3)7-9-17/h6-14,16H,1-5H3,(H,21,23) |
| InChIKey | WUJBIEUMZFBOSM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|