C12H17ClNO4P — CID 59483411
ethyl (2S)-2-[[(4-chlorophenoxy)-methylphosphoryl]amino]propanoate (PubChem CID 59483411) has the molecular formula C12H17ClNO4P and a molecular weight of 305.70 g/mol. Its IUPAC name is ethyl (2S)-2-[[(4-chlorophenoxy)-methylphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(4-chlorophenoxy)-methylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 59483411 |
| Molecular Formula | C12H17ClNO4P |
| Molecular Weight | 305.70 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | ethyl (2S)-2-[[(4-chlorophenoxy)-methylphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(C)(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClNO4P/c1-4-17-12(15)9(2)14-19(3,16)18-11-7-5-10(13)6-8-11/h5-9H,4H2,1-3H3,(H,14,16)/t9-,19?/m0/s1 |
| InChIKey | VXEDJFSUIOROHM-DUOAPZILSA-N |
| XLogP | 3.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|