C11H15ClNO5P — CID 69006691
(3-chlorophenoxy)-N-(1-ethoxy-1-oxopropan-2-yl)phosphonamidic acid (PubChem CID 69006691) has the molecular formula C11H15ClNO5P and a molecular weight of 307.67 g/mol. Its IUPAC name is (3-chlorophenoxy)-N-(1-ethoxy-1-oxopropan-2-yl)phosphonamidic acid.
| Compound Name | (3-chlorophenoxy)-N-(1-ethoxy-1-oxopropan-2-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 69006691 |
| Molecular Formula | C11H15ClNO5P |
| Molecular Weight | 307.67 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (3-chlorophenoxy)-N-(1-ethoxy-1-oxopropan-2-yl)phosphonamidic acid |
| SMILES | CCOC(=O)C(C)NP(=O)(O)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15ClNO5P/c1-3-17-11(14)8(2)13-19(15,16)18-10-6-4-5-9(12)7-10/h4-8H,3H2,1-2H3,(H2,13,15,16) |
| InChIKey | NYUWZNGUYJVDOW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.67 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|