C12H15ClNO5P — CID 130280548
(4-chlorophenoxy)-N-[(2S)-1-ethoxy-1-oxobut-3-en-2-yl]phosphonamidic acid (PubChem CID 130280548) has the molecular formula C12H15ClNO5P and a molecular weight of 319.68 g/mol. Its IUPAC name is (4-chlorophenoxy)-N-[(2S)-1-ethoxy-1-oxobut-3-en-2-yl]phosphonamidic acid.
| Compound Name | (4-chlorophenoxy)-N-[(2S)-1-ethoxy-1-oxobut-3-en-2-yl]phosphonamidic acid |
|---|---|
| PubChem CID | 130280548 |
| Molecular Formula | C12H15ClNO5P |
| Molecular Weight | 319.68 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | (4-chlorophenoxy)-N-[(2S)-1-ethoxy-1-oxobut-3-en-2-yl]phosphonamidic acid |
| SMILES | C=C[C@H](NP(=O)(O)Oc1ccc(Cl)cc1)C(=O)OCC |
| InChI | InChI=1S/C12H15ClNO5P/c1-3-11(12(15)18-4-2)14-20(16,17)19-10-7-5-9(13)6-8-10/h3,5-8,11H,1,4H2,2H3,(H2,14,16,17)/t11-/m0/s1 |
| InChIKey | BFPGNNPKRJBLDP-NSHDSACASA-N |
| XLogP | 2.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.68 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|