C9H9Cl2INO4P — CID 143327902
methyl (2S)-2-[[chloro-(4-chlorophenoxy)phosphoryl]amino]-2-iodoacetate (PubChem CID 143327902) has the molecular formula C9H9Cl2INO4P and a molecular weight of 423.96 g/mol. Its IUPAC name is methyl (2S)-2-[[chloro-(4-chlorophenoxy)phosphoryl]amino]-2-iodoacetate.
| Compound Name | methyl (2S)-2-[[chloro-(4-chlorophenoxy)phosphoryl]amino]-2-iodoacetate |
|---|---|
| PubChem CID | 143327902 |
| Molecular Formula | C9H9Cl2INO4P |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 422.87 |
| IUPAC Name | methyl (2S)-2-[[chloro-(4-chlorophenoxy)phosphoryl]amino]-2-iodoacetate |
| SMILES | COC(=O)[C@H](I)NP(=O)(Cl)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9Cl2INO4P/c1-16-9(14)8(12)13-18(11,15)17-7-4-2-6(10)3-5-7/h2-5,8H,1H3,(H,13,15)/t8-,18?/m1/s1 |
| InChIKey | XUKLGGNVCGNJDB-XENHGZCFSA-N |
| XLogP | 3.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|