C12H15ClNO6P — CID 11994048
dimethyl (2R)-2-[[chloro(phenoxy)phosphoryl]amino]butanedioate (PubChem CID 11994048) has the molecular formula C12H15ClNO6P and a molecular weight of 335.68 g/mol. Its IUPAC name is dimethyl (2R)-2-[[chloro(phenoxy)phosphoryl]amino]butanedioate.
| Compound Name | dimethyl (2R)-2-[[chloro(phenoxy)phosphoryl]amino]butanedioate |
|---|---|
| PubChem CID | 11994048 |
| Molecular Formula | C12H15ClNO6P |
| Molecular Weight | 335.68 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | dimethyl (2R)-2-[[chloro(phenoxy)phosphoryl]amino]butanedioate |
| SMILES | COC(=O)C[C@@H](NP(=O)(Cl)Oc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C12H15ClNO6P/c1-18-11(15)8-10(12(16)19-2)14-21(13,17)20-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,14,17)/t10-,21?/m1/s1 |
| InChIKey | OCUHBMUCLMOHMC-KXPFFURISA-N |
| XLogP | 2.11 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.68 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|