C20H19ClNO4P — CID 11502299
methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 11502299) has the molecular formula C20H19ClNO4P and a molecular weight of 403.80 g/mol. Its IUPAC name is methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11502299 |
| Molecular Formula | C20H19ClNO4P |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NP(=O)(Cl)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C20H19ClNO4P/c1-25-20(23)18(14-15-8-3-2-4-9-15)22-27(21,24)26-19-13-7-11-16-10-5-6-12-17(16)19/h2-13,18H,14H2,1H3,(H,22,24)/t18-,27?/m0/s1 |
| InChIKey | HRIMGZMGBSIBIV-HSYKDVHTSA-N |
| XLogP | 4.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|