C19H23ClNO4P — CID 87148068
cyclopropylmethyl 2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-methylbutanoate (PubChem CID 87148068) has the molecular formula C19H23ClNO4P and a molecular weight of 395.82 g/mol. Its IUPAC name is cyclopropylmethyl 2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-methylbutanoate.
| Compound Name | cyclopropylmethyl 2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 87148068 |
| Molecular Formula | C19H23ClNO4P |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | cyclopropylmethyl 2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-methylbutanoate |
| SMILES | CC(C)C(NP(=O)(Cl)Oc1cccc2ccccc12)C(=O)OCC1CC1 |
| InChI | InChI=1S/C19H23ClNO4P/c1-13(2)18(19(22)24-12-14-10-11-14)21-26(20,23)25-17-9-5-7-15-6-3-4-8-16(15)17/h3-9,13-14,18H,10-12H2,1-2H3,(H,21,23) |
| InChIKey | UVESYWFBJDZTSO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|