C13H18Cl2NO4P — CID 123543136
2-methylpropyl 2-[[chloro-(2-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 123543136) has the molecular formula C13H18Cl2NO4P and a molecular weight of 354.17 g/mol. Its IUPAC name is 2-methylpropyl 2-[[chloro-(2-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | 2-methylpropyl 2-[[chloro-(2-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123543136 |
| Molecular Formula | C13H18Cl2NO4P |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-methylpropyl 2-[[chloro-(2-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)COC(=O)C(C)NP(=O)(Cl)Oc1ccccc1Cl |
| InChI | InChI=1S/C13H18Cl2NO4P/c1-9(2)8-19-13(17)10(3)16-21(15,18)20-12-7-5-4-6-11(12)14/h4-7,9-10H,8H2,1-3H3,(H,16,18) |
| InChIKey | FSBOSKMMIXHSLX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|