C15H21ClNO6P — CID 87527133
ethyl (2R)-2-[[chloro-[2-(3-methoxy-3-oxopropyl)phenoxy]phosphoryl]amino]propanoate (PubChem CID 87527133) has the molecular formula C15H21ClNO6P and a molecular weight of 377.76 g/mol. Its IUPAC name is ethyl (2R)-2-[[chloro-[2-(3-methoxy-3-oxopropyl)phenoxy]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[chloro-[2-(3-methoxy-3-oxopropyl)phenoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 87527133 |
| Molecular Formula | C15H21ClNO6P |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | ethyl (2R)-2-[[chloro-[2-(3-methoxy-3-oxopropyl)phenoxy]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NP(=O)(Cl)Oc1ccccc1CCC(=O)OC |
| InChI | InChI=1S/C15H21ClNO6P/c1-4-22-15(19)11(2)17-24(16,20)23-13-8-6-5-7-12(13)9-10-14(18)21-3/h5-8,11H,4,9-10H2,1-3H3,(H,17,20)/t11-,24?/m1/s1 |
| InChIKey | AHWMEXKWCDIVHT-ZOLQVCMMSA-N |
| XLogP | 3.06 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|