C23H30NO9PS — CID 86727966
ethyl (2S)-2-[[[2-(3-ethoxy-3-oxopropyl)phenoxy]-(4-methylsulfonylphenoxy)phosphoryl]amino]propanoate (PubChem CID 86727966) has the molecular formula C23H30NO9PS and a molecular weight of 527.53 g/mol. Its IUPAC name is ethyl (2S)-2-[[[2-(3-ethoxy-3-oxopropyl)phenoxy]-(4-methylsulfonylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[2-(3-ethoxy-3-oxopropyl)phenoxy]-(4-methylsulfonylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 86727966 |
| Molecular Formula | C23H30NO9PS |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | ethyl (2S)-2-[[[2-(3-ethoxy-3-oxopropyl)phenoxy]-(4-methylsulfonylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)CCc1ccccc1OP(=O)(N[C@@H](C)C(=O)OCC)Oc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H30NO9PS/c1-5-30-22(25)16-11-18-9-7-8-10-21(18)33-34(27,24-17(3)23(26)31-6-2)32-19-12-14-20(15-13-19)35(4,28)29/h7-10,12-15,17H,5-6,11,16H2,1-4H3,(H,24,27)/t17-,34?/m0/s1 |
| InChIKey | UWAPHECNJWZNEL-PJEDDKAUSA-N |
| XLogP | 3.69 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|