C18H22N2O6P+ — CID 157191496
[4-[[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxyphenyl]-hydroxy-methylideneazanium (PubChem CID 157191496) has the molecular formula C18H22N2O6P+ and a molecular weight of 393.36 g/mol. Its IUPAC name is [4-[[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxyphenyl]-hydroxy-methylideneazanium.
| Compound Name | [4-[[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxyphenyl]-hydroxy-methylideneazanium |
|---|---|
| PubChem CID | 157191496 |
| Molecular Formula | C18H22N2O6P+ |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [4-[[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxyphenyl]-hydroxy-methylideneazanium |
| SMILES | C=[N+](O)c1ccc(O[P@@](=O)(N[C@@H](C)C(=O)OCC)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O6P/c1-4-24-18(21)14(2)19-27(23,25-16-8-6-5-7-9-16)26-17-12-10-15(11-13-17)20(3)22/h5-14,22H,3-4H2,1-2H3,(H,19,23)/q+1/t14-,27+/m0/s1 |
| InChIKey | JVXIUOSSNAVOPS-PGGUUEOZSA-N |
| XLogP | 3.53 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|