C14H22NO3PS — CID 134165823
ethyl (2R)-2-[[phenoxy(propan-2-yl)phosphinothioyl]amino]propanoate (PubChem CID 134165823) has the molecular formula C14H22NO3PS and a molecular weight of 315.38 g/mol. Its IUPAC name is ethyl (2R)-2-[[phenoxy(propan-2-yl)phosphinothioyl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[phenoxy(propan-2-yl)phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 134165823 |
| Molecular Formula | C14H22NO3PS |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl (2R)-2-[[phenoxy(propan-2-yl)phosphinothioyl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NP(=S)(Oc1ccccc1)C(C)C |
| InChI | InChI=1S/C14H22NO3PS/c1-5-17-14(16)12(4)15-19(20,11(2)3)18-13-9-7-6-8-10-13/h6-12H,5H2,1-4H3,(H,15,20)/t12-,19?/m1/s1 |
| InChIKey | MYHRUBHPVUIVDB-ISGGMURCSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|