C16H27N2O5P — CID 71120514
ethyl (2S)-2-[[[(2R)-1-(methylamino)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 71120514) has the molecular formula C16H27N2O5P and a molecular weight of 358.38 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R)-1-(methylamino)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R)-1-(methylamino)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 71120514 |
| Molecular Formula | C16H27N2O5P |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | ethyl (2S)-2-[[[(2R)-1-(methylamino)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(CO[C@H](C)CNC)Oc1ccccc1 |
| InChI | InChI=1S/C16H27N2O5P/c1-5-21-16(19)14(3)18-24(20,12-22-13(2)11-17-4)23-15-9-7-6-8-10-15/h6-10,13-14,17H,5,11-12H2,1-4H3,(H,18,20)/t13-,14+,24?/m1/s1 |
| InChIKey | AYKNTJLNTIQPAB-OQDLIYHKSA-N |
| XLogP | 2.38 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|