C19H24NO5P — CID 131990521
ethyl (2S)-2-[[phenoxy(phenylmethoxymethyl)phosphoryl]amino]propanoate (PubChem CID 131990521) has the molecular formula C19H24NO5P and a molecular weight of 377.38 g/mol. Its IUPAC name is ethyl (2S)-2-[[phenoxy(phenylmethoxymethyl)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[phenoxy(phenylmethoxymethyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 131990521 |
| Molecular Formula | C19H24NO5P |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | ethyl (2S)-2-[[phenoxy(phenylmethoxymethyl)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(COCc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C19H24NO5P/c1-3-24-19(21)16(2)20-26(22,25-18-12-8-5-9-13-18)15-23-14-17-10-6-4-7-11-17/h4-13,16H,3,14-15H2,1-2H3,(H,20,22)/t16-,26?/m0/s1 |
| InChIKey | YRXNLOURPOQKFF-AJWVYOOVSA-N |
| XLogP | 3.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|