C16H17INO4P — CID 145274356
benzyl (2S)-2-[[iodo(phenoxy)phosphoryl]amino]propanoate (PubChem CID 145274356) has the molecular formula C16H17INO4P and a molecular weight of 445.19 g/mol. Its IUPAC name is benzyl (2S)-2-[[iodo(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[iodo(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 145274356 |
| Molecular Formula | C16H17INO4P |
| Molecular Weight | 445.19 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | benzyl (2S)-2-[[iodo(phenoxy)phosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@@](=O)(I)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H17INO4P/c1-13(16(19)21-12-14-8-4-2-5-9-14)18-23(17,20)22-15-10-6-3-7-11-15/h2-11,13H,12H2,1H3,(H,18,20)/t13-,23+/m0/s1 |
| InChIKey | XBIUFMJTPDRBRP-ZAMGYDSWSA-N |
| XLogP | 4.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|