C13H19INO4P — CID 163894846
propan-2-yl (2S)-2-[[iodo-(4-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 163894846) has the molecular formula C13H19INO4P and a molecular weight of 411.18 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[iodo-(4-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[iodo-(4-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163894846 |
| Molecular Formula | C13H19INO4P |
| Molecular Weight | 411.18 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | propan-2-yl (2S)-2-[[iodo-(4-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | Cc1ccc(OP(=O)(I)N[C@@H](C)C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C13H19INO4P/c1-9(2)18-13(16)11(4)15-20(14,17)19-12-7-5-10(3)6-8-12/h5-9,11H,1-4H3,(H,15,17)/t11-,20?/m0/s1 |
| InChIKey | QESBOXRFUBWAPM-ZOZMEPSFSA-N |
| XLogP | 3.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|