C14H22NO4P — CID 126647669
propan-2-yl (2S)-2-[[methyl-(3-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 126647669) has the molecular formula C14H22NO4P and a molecular weight of 299.31 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[methyl-(3-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[methyl-(3-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126647669 |
| Molecular Formula | C14H22NO4P |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[methyl-(3-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | Cc1cccc(OP(C)(=O)N[C@@H](C)C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C14H22NO4P/c1-10(2)18-14(16)12(4)15-20(5,17)19-13-8-6-7-11(3)9-13/h6-10,12H,1-5H3,(H,15,17)/t12-,20?/m0/s1 |
| InChIKey | AMBZPKZTJQCYDW-SVZXGPMESA-N |
| XLogP | 3.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|