C17H28NO5P — CID 126647572
propan-2-yl (2S)-2-[[tert-butyl-(3-methoxyphenoxy)phosphoryl]amino]propanoate (PubChem CID 126647572) has the molecular formula C17H28NO5P and a molecular weight of 357.39 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[tert-butyl-(3-methoxyphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[tert-butyl-(3-methoxyphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126647572 |
| Molecular Formula | C17H28NO5P |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[tert-butyl-(3-methoxyphenoxy)phosphoryl]amino]propanoate |
| SMILES | COc1cccc(O[P@](=O)(N[C@@H](C)C(=O)OC(C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H28NO5P/c1-12(2)22-16(19)13(3)18-24(20,17(4,5)6)23-15-10-8-9-14(11-15)21-7/h8-13H,1-7H3,(H,18,20)/t13-,24-/m0/s1 |
| InChIKey | MSIMEWLHMSHQJO-RZFZLAGVSA-N |
| XLogP | 4.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|