C17H28NO3P — CID 135258081
(2S)-N-[tert-butyl(phenoxy)phosphoryl]-3-propan-2-yloxybut-3-en-2-amine (PubChem CID 135258081) has the molecular formula C17H28NO3P and a molecular weight of 325.39 g/mol. Its IUPAC name is (2S)-N-[tert-butyl(phenoxy)phosphoryl]-3-propan-2-yloxybut-3-en-2-amine.
| Compound Name | (2S)-N-[tert-butyl(phenoxy)phosphoryl]-3-propan-2-yloxybut-3-en-2-amine |
|---|---|
| PubChem CID | 135258081 |
| Molecular Formula | C17H28NO3P |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (2S)-N-[tert-butyl(phenoxy)phosphoryl]-3-propan-2-yloxybut-3-en-2-amine |
| SMILES | C=C(OC(C)C)[C@H](C)NP(=O)(Oc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H28NO3P/c1-13(2)20-15(4)14(3)18-22(19,17(5,6)7)21-16-11-9-8-10-12-16/h8-14H,4H2,1-3,5-7H3,(H,18,19)/t14-,22?/m0/s1 |
| InChIKey | XRFUUJCDVYLNOG-XLEXHMCLSA-N |
| XLogP | 4.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|