C16H24F3N2O6PS — CID 175908909
propan-2-yl (2S)-2-[[2-aminoethylsulfanyl(phenoxy)phosphoryl]amino]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 175908909) has the molecular formula C16H24F3N2O6PS and a molecular weight of 460.41 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[2-aminoethylsulfanyl(phenoxy)phosphoryl]amino]propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | propan-2-yl (2S)-2-[[2-aminoethylsulfanyl(phenoxy)phosphoryl]amino]propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175908909 |
| Molecular Formula | C16H24F3N2O6PS |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | propan-2-yl (2S)-2-[[2-aminoethylsulfanyl(phenoxy)phosphoryl]amino]propanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@@](=O)(Oc1ccccc1)SCCN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H23N2O4PS.C2HF3O2/c1-11(2)19-14(17)12(3)16-21(18,22-10-9-15)20-13-7-5-4-6-8-13;3-2(4,5)1(6)7/h4-8,11-12H,9-10,15H2,1-3H3,(H,16,18);(H,6,7)/t12-,21+;/m0./s1 |
| InChIKey | AEOMWWDDDRWEFH-HGYXHXFYSA-N |
| XLogP | 3.43 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|