C18H20Cl2NO4PS — CID 118973866
propan-2-yl (2S)-2-[[(3,5-dichlorophenyl)sulfanyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 118973866) has the molecular formula C18H20Cl2NO4PS and a molecular weight of 448.31 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(3,5-dichlorophenyl)sulfanyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(3,5-dichlorophenyl)sulfanyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118973866 |
| Molecular Formula | C18H20Cl2NO4PS |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | propan-2-yl (2S)-2-[[(3,5-dichlorophenyl)sulfanyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(Oc1ccccc1)Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2NO4PS/c1-12(2)24-18(22)13(3)21-26(23,25-16-7-5-4-6-8-16)27-17-10-14(19)9-15(20)11-17/h4-13H,1-3H3,(H,21,23)/t13-,26?/m0/s1 |
| InChIKey | BUMHWOHHIZBEDC-ABGKOZRJSA-N |
| XLogP | 6.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|