C15H14Cl2NO4PS — CID 118962482
2-[[(3,5-dichlorophenyl)sulfanyl-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 118962482) has the molecular formula C15H14Cl2NO4PS and a molecular weight of 406.23 g/mol. Its IUPAC name is 2-[[(3,5-dichlorophenyl)sulfanyl-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[(3,5-dichlorophenyl)sulfanyl-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 118962482 |
| Molecular Formula | C15H14Cl2NO4PS |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 2-[[(3,5-dichlorophenyl)sulfanyl-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | CC(NP(=O)(Oc1ccccc1)Sc1cc(Cl)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C15H14Cl2NO4PS/c1-10(15(19)20)18-23(21,22-13-5-3-2-4-6-13)24-14-8-11(16)7-12(17)9-14/h2-10H,1H3,(H,18,21)(H,19,20) |
| InChIKey | YTSMNRSFLWBSBN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|