C9H10ClINO4P — CID 130297948
2-[[chloro-(4-iodophenoxy)phosphoryl]amino]propanoic acid (PubChem CID 130297948) has the molecular formula C9H10ClINO4P and a molecular weight of 389.51 g/mol. Its IUPAC name is 2-[[chloro-(4-iodophenoxy)phosphoryl]amino]propanoic acid.
| Compound Name | 2-[[chloro-(4-iodophenoxy)phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 130297948 |
| Molecular Formula | C9H10ClINO4P |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 388.91 |
| IUPAC Name | 2-[[chloro-(4-iodophenoxy)phosphoryl]amino]propanoic acid |
| SMILES | CC(NP(=O)(Cl)Oc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C9H10ClINO4P/c1-6(9(13)14)12-17(10,15)16-8-4-2-7(11)3-5-8/h2-6H,1H3,(H,12,15)(H,13,14) |
| InChIKey | YATHDRKQPFUMEA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|