C13H19ClNO3P — CID 122518408
(5S)-5-[[chloro(phenoxy)phosphoryl]amino]-4-methylhexan-3-one (PubChem CID 122518408) has the molecular formula C13H19ClNO3P and a molecular weight of 303.73 g/mol. Its IUPAC name is (5S)-5-[[chloro(phenoxy)phosphoryl]amino]-4-methylhexan-3-one.
| Compound Name | (5S)-5-[[chloro(phenoxy)phosphoryl]amino]-4-methylhexan-3-one |
|---|---|
| PubChem CID | 122518408 |
| Molecular Formula | C13H19ClNO3P |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (5S)-5-[[chloro(phenoxy)phosphoryl]amino]-4-methylhexan-3-one |
| SMILES | CCC(=O)C(C)[C@H](C)NP(=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C13H19ClNO3P/c1-4-13(16)10(2)11(3)15-19(14,17)18-12-8-6-5-7-9-12/h5-11H,4H2,1-3H3,(H,15,17)/t10?,11-,19?/m0/s1 |
| InChIKey | PMUGSVNENYMNNZ-JVIGMCFJSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|