C21H27ClNO4P — CID 171611728
2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 171611728) has the molecular formula C21H27ClNO4P and a molecular weight of 423.88 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 171611728 |
| Molecular Formula | C21H27ClNO4P |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | CCC(CC)COC(=O)[C@H](Cc1ccccc1)NP(=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C21H27ClNO4P/c1-3-17(4-2)16-26-21(24)20(15-18-11-7-5-8-12-18)23-28(22,25)27-19-13-9-6-10-14-19/h5-14,17,20H,3-4,15-16H2,1-2H3,(H,23,25)/t20-,28?/m0/s1 |
| InChIKey | HNTICLZXLYPEBA-CQHAJPFMSA-N |
| XLogP | 5.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|