About 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate
2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 171611728) has the molecular formula C21H27ClNO4P
and a molecular weight of 423.88 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate |
| PubChem CID | 171611728 |
| Molecular Formula | C21H27ClNO4P |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | CCC(CC)COC(=O)[C@H](Cc1ccccc1)NP(=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C21H27ClNO4P/c1-3-17(4-2)16-26-21(24)20(15-18-11-7-5-8-12-18)23-28(22,25)27-19-13-9-6-10-14-19/h5-14,17,20H,3-4,15-16H2,1-2H3,(H,23,25)/t20-,28?/m0/s1 |
| InChIKey | HNTICLZXLYPEBA-CQHAJPFMSA-N |
| XLogP | 5.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate?
The IUPAC name of 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate (CID 171611728) is 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate.
What is the SMILES notation for 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate?
The canonical SMILES for 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate is CCC(CC)COC(=O)[C@H](Cc1ccccc1)NP(=O)(Cl)Oc1ccccc1.
What is the InChIKey of 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate?
The InChIKey is HNTICLZXLYPEBA-CQHAJPFMSA-N. The full InChI is InChI=1S/C21H27ClNO4P/c1-3-17(4-2)16-26-21(24)20(15-18-11-7-5-8-12-18)23-28(22,25)27-19-13-9-6-10-14-19/h5-14,17,20H,3-4,15-16H2,1-2H3,(H,23,25)/t20-,28?/m0/s1.
What are the key properties of 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate?
2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate has a molecular weight of 423.88 g/mol, XLogP of 5.59, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutyl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-3-phenylpropanoate is sourced from PubChem (CID 171611728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).