C21H31N2O4P — CID 169219377
ethane;propan-2-yl (2S)-2-[[methylamino(phenoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 169219377) has the molecular formula C21H31N2O4P and a molecular weight of 406.46 g/mol. Its IUPAC name is ethane;propan-2-yl (2S)-2-[[methylamino(phenoxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | ethane;propan-2-yl (2S)-2-[[methylamino(phenoxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 169219377 |
| Molecular Formula | C21H31N2O4P |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | ethane;propan-2-yl (2S)-2-[[methylamino(phenoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | CC.CNP(=O)(N[C@@H](Cc1ccccc1)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C19H25N2O4P.C2H6/c1-15(2)24-19(22)18(14-16-10-6-4-7-11-16)21-26(23,20-3)25-17-12-8-5-9-13-17;1-2/h4-13,15,18H,14H2,1-3H3,(H2,20,21,23);1-2H3/t18-,26?;/m0./s1 |
| InChIKey | KIVHHHHXWLDEPI-BJUYUVSNSA-N |
| XLogP | 4.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|