C24H35N4O8P — CID 126555385
propan-2-yl 6-imino-2-[[[(6-imino-1,5-dioxo-1-propan-2-yloxyhexan-2-yl)amino]-phenoxyphosphoryl]amino]-5-oxohexanoate (PubChem CID 126555385) has the molecular formula C24H35N4O8P and a molecular weight of 538.54 g/mol. Its IUPAC name is propan-2-yl 6-imino-2-[[[(6-imino-1,5-dioxo-1-propan-2-yloxyhexan-2-yl)amino]-phenoxyphosphoryl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl 6-imino-2-[[[(6-imino-1,5-dioxo-1-propan-2-yloxyhexan-2-yl)amino]-phenoxyphosphoryl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 126555385 |
| Molecular Formula | C24H35N4O8P |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | propan-2-yl 6-imino-2-[[[(6-imino-1,5-dioxo-1-propan-2-yloxyhexan-2-yl)amino]-phenoxyphosphoryl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CCC(NP(=O)(NC(CCC(=O)/C=N/[H])C(=O)OC(C)C)Oc1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C24H35N4O8P/c1-16(2)34-23(31)21(12-10-18(29)14-25)27-37(33,36-20-8-6-5-7-9-20)28-22(13-11-19(30)15-26)24(32)35-17(3)4/h5-9,14-17,21-22,25-26H,10-13H2,1-4H3,(H2,27,28,33)/b25-14+,26-15+ |
| InChIKey | GXEBCLIWMWRYPT-LVSXPEEVSA-N |
| XLogP | 2.99 |
| TPSA | 184.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|