C16H20FN3O5 — CID 167015803
propan-2-yl (2S)-2-[[(2R)-2-(3-fluoro-4-pyridinyl)-2-hydroxyacetyl]amino]-6-imino-5-oxohexanoate (PubChem CID 167015803) has the molecular formula C16H20FN3O5 and a molecular weight of 353.35 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2R)-2-(3-fluoro-4-pyridinyl)-2-hydroxyacetyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2R)-2-(3-fluoro-4-pyridinyl)-2-hydroxyacetyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 167015803 |
| Molecular Formula | C16H20FN3O5 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2R)-2-(3-fluoro-4-pyridinyl)-2-hydroxyacetyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](O)c1ccncc1F)C(=O)OC(C)C |
| InChI | InChI=1S/C16H20FN3O5/c1-9(2)25-16(24)13(4-3-10(21)7-18)20-15(23)14(22)11-5-6-19-8-12(11)17/h5-9,13-14,18,22H,3-4H2,1-2H3,(H,20,23)/b18-7+/t13-,14+/m0/s1 |
| InChIKey | NHRQOJJVXWZPBQ-OZRPHMTASA-N |
| XLogP | 0.69 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|