C15H26N2O4S2 — CID 167015747
propan-2-yl (2S)-2-[[(2S)-2,4-bis(methylsulfanyl)butanoyl]amino]-6-imino-5-oxohexanoate (PubChem CID 167015747) has the molecular formula C15H26N2O4S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-2,4-bis(methylsulfanyl)butanoyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-2,4-bis(methylsulfanyl)butanoyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 167015747 |
| Molecular Formula | C15H26N2O4S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-2,4-bis(methylsulfanyl)butanoyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CCSC)SC)C(=O)OC(C)C |
| InChI | InChI=1S/C15H26N2O4S2/c1-10(2)21-15(20)12(6-5-11(18)9-16)17-14(19)13(23-4)7-8-22-3/h9-10,12-13,16H,5-8H2,1-4H3,(H,17,19)/b16-9+/t12-,13-/m0/s1 |
| InChIKey | CLBGQBOBIGYUHX-CSBKXELUSA-N |
| XLogP | 1.91 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|