C17H28N2O6 — CID 167015094
propan-2-yl (2S)-2-[[(2S)-2-(2,2-dimethylpropanoyloxy)propanoyl]amino]-6-imino-5-oxohexanoate (PubChem CID 167015094) has the molecular formula C17H28N2O6 and a molecular weight of 356.42 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-2-(2,2-dimethylpropanoyloxy)propanoyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-2-(2,2-dimethylpropanoyloxy)propanoyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 167015094 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-2-(2,2-dimethylpropanoyloxy)propanoyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](C)OC(=O)C(C)(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C17H28N2O6/c1-10(2)24-15(22)13(8-7-12(20)9-18)19-14(21)11(3)25-16(23)17(4,5)6/h9-11,13,18H,7-8H2,1-6H3,(H,19,21)/b18-9+/t11-,13-/m0/s1 |
| InChIKey | GBCUDJUAZXZECI-WJEQHTBISA-N |
| XLogP | 1.40 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|