C17H30N2O5 — CID 167014877
propan-2-yl (2S)-6-imino-5-oxo-2-[[(2S)-2-propan-2-yloxypentanoyl]amino]hexanoate (PubChem CID 167014877) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-5-oxo-2-[[(2S)-2-propan-2-yloxypentanoyl]amino]hexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-5-oxo-2-[[(2S)-2-propan-2-yloxypentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 167014877 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | propan-2-yl (2S)-6-imino-5-oxo-2-[[(2S)-2-propan-2-yloxypentanoyl]amino]hexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CCC)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C17H30N2O5/c1-6-7-15(23-11(2)3)16(21)19-14(9-8-13(20)10-18)17(22)24-12(4)5/h10-12,14-15,18H,6-9H2,1-5H3,(H,19,21)/b18-10+/t14-,15-/m0/s1 |
| InChIKey | WNJKZKXCOPINPW-CXJPLEHTSA-N |
| XLogP | 2.02 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|