C16H28N2O5 — CID 170445067
propan-2-yl (2S)-2-[[(2S)-2-hydroxyhexanoyl]amino]-7-imino-6-oxoheptanoate (PubChem CID 170445067) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-2-hydroxyhexanoyl]amino]-7-imino-6-oxoheptanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-2-hydroxyhexanoyl]amino]-7-imino-6-oxoheptanoate |
|---|---|
| PubChem CID | 170445067 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-2-hydroxyhexanoyl]amino]-7-imino-6-oxoheptanoate |
| SMILES | [H]/N=C/C(=O)CCC[C@H](NC(=O)[C@@H](O)CCCC)C(=O)OC(C)C |
| InChI | InChI=1S/C16H28N2O5/c1-4-5-9-14(20)15(21)18-13(16(22)23-11(2)3)8-6-7-12(19)10-17/h10-11,13-14,17,20H,4-9H2,1-3H3,(H,18,21)/b17-10+/t13-,14-/m0/s1 |
| InChIKey | OBJRDMGBQJOLAQ-JUACWREWSA-N |
| XLogP | 1.36 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|