C14H21N3O6 — CID 170445719
propan-2-yl (2S)-2-[[(2R)-2-(4,5-dihydro-1,3-oxazol-5-yl)-2-hydroxyacetyl]amino]-6-imino-5-oxohexanoate (PubChem CID 170445719) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2R)-2-(4,5-dihydro-1,3-oxazol-5-yl)-2-hydroxyacetyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2R)-2-(4,5-dihydro-1,3-oxazol-5-yl)-2-hydroxyacetyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 170445719 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2R)-2-(4,5-dihydro-1,3-oxazol-5-yl)-2-hydroxyacetyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](O)C1CN=CO1)C(=O)OC(C)C |
| InChI | InChI=1S/C14H21N3O6/c1-8(2)23-14(21)10(4-3-9(18)5-15)17-13(20)12(19)11-6-16-7-22-11/h5,7-8,10-12,15,19H,3-4,6H2,1-2H3,(H,17,20)/b15-5+/t10-,11?,12+/m0/s1 |
| InChIKey | RWUPBCGSFMLEAB-QNUXTNCZSA-N |
| XLogP | -0.79 |
| TPSA | 138.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|