C15H21N3O5S — CID 167015291
propan-2-yl (2S)-6-imino-2-[[(2R)-2-methoxy-2-(1,3-thiazol-5-yl)acetyl]amino]-5-oxohexanoate (PubChem CID 167015291) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-2-[[(2R)-2-methoxy-2-(1,3-thiazol-5-yl)acetyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-2-[[(2R)-2-methoxy-2-(1,3-thiazol-5-yl)acetyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167015291 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | propan-2-yl (2S)-6-imino-2-[[(2R)-2-methoxy-2-(1,3-thiazol-5-yl)acetyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](OC)c1cncs1)C(=O)OC(C)C |
| InChI | InChI=1S/C15H21N3O5S/c1-9(2)23-15(21)11(5-4-10(19)6-16)18-14(20)13(22-3)12-7-17-8-24-12/h6-9,11,13,16H,4-5H2,1-3H3,(H,18,20)/b16-6+/t11-,13-/m0/s1 |
| InChIKey | YGHWUFXIHCINHO-QKSTXFTRSA-N |
| XLogP | 1.27 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|