C14H21N3O5 — CID 167015121
[(2S)-1-cyanopropan-2-yl] (2S)-6-imino-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate (PubChem CID 167015121) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is [(2S)-1-cyanopropan-2-yl] (2S)-6-imino-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate.
| Compound Name | [(2S)-1-cyanopropan-2-yl] (2S)-6-imino-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167015121 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(2S)-1-cyanopropan-2-yl] (2S)-6-imino-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](C)OC)C(=O)O[C@@H](C)CC#N |
| InChI | InChI=1S/C14H21N3O5/c1-9(6-7-15)22-14(20)12(5-4-11(18)8-16)17-13(19)10(2)21-3/h8-10,12,16H,4-6H2,1-3H3,(H,17,19)/b16-8+/t9-,10-,12-/m0/s1 |
| InChIKey | CJXNBPSGMMIGIR-KTNPVYTESA-N |
| XLogP | 0.35 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|