C17H28N2O5 — CID 167014896
cycloheptyl (2S)-6-imino-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate (PubChem CID 167014896) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is cycloheptyl (2S)-6-imino-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate.
| Compound Name | cycloheptyl (2S)-6-imino-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167014896 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | cycloheptyl (2S)-6-imino-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](C)OC)C(=O)OC1CCCCCC1 |
| InChI | InChI=1S/C17H28N2O5/c1-12(23-2)16(21)19-15(10-9-13(20)11-18)17(22)24-14-7-5-3-4-6-8-14/h11-12,14-15,18H,3-10H2,1-2H3,(H,19,21)/b18-11+/t12-,15+/m1/s1 |
| InChIKey | HDLIKWRVNPJFDW-LEMBFTOYSA-N |
| XLogP | 1.77 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|