C16H25N3O6 — CID 170443847
[(4R)-oxepan-4-yl] (2S)-6-diazo-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate (PubChem CID 170443847) has the molecular formula C16H25N3O6 and a molecular weight of 355.39 g/mol. Its IUPAC name is [(4R)-oxepan-4-yl] (2S)-6-diazo-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate.
| Compound Name | [(4R)-oxepan-4-yl] (2S)-6-diazo-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170443847 |
| Molecular Formula | C16H25N3O6 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | [(4R)-oxepan-4-yl] (2S)-6-diazo-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate |
| SMILES | CO[C@H](C)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)O[C@@H]1CCCOCC1 |
| InChI | InChI=1S/C16H25N3O6/c1-11(23-2)15(21)19-14(6-5-12(20)10-18-17)16(22)25-13-4-3-8-24-9-7-13/h10-11,13-14H,3-9H2,1-2H3,(H,19,21)/t11-,13-,14+/m1/s1 |
| InChIKey | DCIJDLULAJFAHD-BNOWGMLFSA-N |
| XLogP | 0.27 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|