C17H21N3O5 — CID 170443831
benzyl (2S)-6-diazo-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate (PubChem CID 170443831) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is benzyl (2S)-6-diazo-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate.
| Compound Name | benzyl (2S)-6-diazo-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170443831 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | benzyl (2S)-6-diazo-2-[[(2R)-2-methoxypropanoyl]amino]-5-oxohexanoate |
| SMILES | CO[C@H](C)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H21N3O5/c1-12(24-2)16(22)20-15(9-8-14(21)10-19-18)17(23)25-11-13-6-4-3-5-7-13/h3-7,10,12,15H,8-9,11H2,1-2H3,(H,20,22)/t12-,15+/m1/s1 |
| InChIKey | MPGNWQNZWRMISN-DOMZBBRYSA-N |
| XLogP | 0.90 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|