C13H21N3O4S — CID 175969024
S-(1,1,1-trideuteriopropan-2-yl) (2S)-6-diazo-5-oxo-2-[[(2S)-2-(trideuteriomethoxy)propanoyl]amino]hexanethioate (PubChem CID 175969024) has the molecular formula C13H21N3O4S and a molecular weight of 321.43 g/mol. Its IUPAC name is S-(1,1,1-trideuteriopropan-2-yl) (2S)-6-diazo-5-oxo-2-[[(2S)-2-(trideuteriomethoxy)propanoyl]amino]hexanethioate.
| Compound Name | S-(1,1,1-trideuteriopropan-2-yl) (2S)-6-diazo-5-oxo-2-[[(2S)-2-(trideuteriomethoxy)propanoyl]amino]hexanethioate |
|---|---|
| PubChem CID | 175969024 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | S-(1,1,1-trideuteriopropan-2-yl) (2S)-6-diazo-5-oxo-2-[[(2S)-2-(trideuteriomethoxy)propanoyl]amino]hexanethioate |
| SMILES | [2H]C([2H])([2H])O[C@@H](C)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)SC(C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H21N3O4S/c1-8(2)21-13(19)11(6-5-10(17)7-15-14)16-12(18)9(3)20-4/h7-9,11H,5-6H2,1-4H3,(H,16,18)/t9-,11-/m0/s1/i1D3,4D3/t8?,9-,11- |
| InChIKey | WLBQAKXIZRDXCN-VKCNELEBSA-N |
| XLogP | 0.82 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|