C9H15N3O2S — CID 170443420
S-propan-2-yl (2S)-2-amino-6-diazo-5-oxohexanethioate (PubChem CID 170443420) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is S-propan-2-yl (2S)-2-amino-6-diazo-5-oxohexanethioate.
| Compound Name | S-propan-2-yl (2S)-2-amino-6-diazo-5-oxohexanethioate |
|---|---|
| PubChem CID | 170443420 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | S-propan-2-yl (2S)-2-amino-6-diazo-5-oxohexanethioate |
| SMILES | CC(C)SC(=O)[C@@H](N)CCC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C9H15N3O2S/c1-6(2)15-9(14)8(10)4-3-7(13)5-12-11/h5-6,8H,3-4,10H2,1-2H3/t8-/m0/s1 |
| InChIKey | XRIREZHJWRGHPR-QMMMGPOBSA-N |
| XLogP | 0.63 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|