C6H9N5O2 — CID 151899976
(2S)-2-amino-5,6-didiazohexanoic acid (PubChem CID 151899976) has the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. Its IUPAC name is (2S)-2-amino-5,6-didiazohexanoic acid.
| Compound Name | (2S)-2-amino-5,6-didiazohexanoic acid |
|---|---|
| PubChem CID | 151899976 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (2S)-2-amino-5,6-didiazohexanoic acid |
| SMILES | [N-]=[N+]=CC(CC[C@H](N)C(=O)O)=[N+]=[N-] |
| InChI | InChI=1S/C6H9N5O2/c7-5(6(12)13)2-1-4(11-9)3-10-8/h3,5H,1-2,7H2,(H,12,13)/t5-/m0/s1 |
| InChIKey | SSOFTVXOUWEAIA-YFKPBYRVSA-N |
| XLogP | -0.85 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|