C10H15N3O5 — CID 101102878
ethyl (2S)-6-diazo-2-(methoxycarbonylamino)-5-oxohexanoate (PubChem CID 101102878) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is ethyl (2S)-6-diazo-2-(methoxycarbonylamino)-5-oxohexanoate.
| Compound Name | ethyl (2S)-6-diazo-2-(methoxycarbonylamino)-5-oxohexanoate |
|---|---|
| PubChem CID | 101102878 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | ethyl (2S)-6-diazo-2-(methoxycarbonylamino)-5-oxohexanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)OC |
| InChI | InChI=1S/C10H15N3O5/c1-3-18-9(15)8(13-10(16)17-2)5-4-7(14)6-12-11/h6,8H,3-5H2,1-2H3,(H,13,16)/t8-/m0/s1 |
| InChIKey | FUFRINFKFZIDRJ-QMMMGPOBSA-N |
| XLogP | -0.08 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|