C12H19N3O6S — CID 170532510
ethyl (2S)-6-diazo-2-[[(2S)-2-methylsulfonylpropanoyl]amino]-5-oxohexanoate (PubChem CID 170532510) has the molecular formula C12H19N3O6S and a molecular weight of 333.37 g/mol. Its IUPAC name is ethyl (2S)-6-diazo-2-[[(2S)-2-methylsulfonylpropanoyl]amino]-5-oxohexanoate.
| Compound Name | ethyl (2S)-6-diazo-2-[[(2S)-2-methylsulfonylpropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170532510 |
| Molecular Formula | C12H19N3O6S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl (2S)-6-diazo-2-[[(2S)-2-methylsulfonylpropanoyl]amino]-5-oxohexanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)[C@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C12H19N3O6S/c1-4-21-12(18)10(6-5-9(16)7-14-13)15-11(17)8(2)22(3,19)20/h7-8,10H,4-6H2,1-3H3,(H,15,17)/t8-,10-/m0/s1 |
| InChIKey | IDGOOQMWVMRTED-WPRPVWTQSA-N |
| XLogP | -0.88 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|