C21H27N3O6 — CID 175729783
ethyl (2S)-6-diazo-2-[[3-(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]-5-oxohexanoate (PubChem CID 175729783) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is ethyl (2S)-6-diazo-2-[[3-(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]-5-oxohexanoate.
| Compound Name | ethyl (2S)-6-diazo-2-[[3-(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 175729783 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | ethyl (2S)-6-diazo-2-[[3-(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]-5-oxohexanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)CC(C)(C)C1=CC(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C21H27N3O6/c1-6-30-20(29)16(8-7-14(25)11-23-22)24-18(27)10-21(4,5)15-9-17(26)12(2)13(3)19(15)28/h9,11,16H,6-8,10H2,1-5H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | ARDFDZSSHROGOS-INIZCTEOSA-N |
| XLogP | 1.52 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|