C21H26BrN3O6 — CID 175729759
ethyl (2S)-2-[[3-(5-bromo-2,4-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 175729759) has the molecular formula C21H26BrN3O6 and a molecular weight of 496.36 g/mol. Its IUPAC name is ethyl (2S)-2-[[3-(5-bromo-2,4-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | ethyl (2S)-2-[[3-(5-bromo-2,4-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 175729759 |
| Molecular Formula | C21H26BrN3O6 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | ethyl (2S)-2-[[3-(5-bromo-2,4-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-methylbutanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)CC(C)(C)C1=C(C)C(=O)C(C)=C(Br)C1=O |
| InChI | InChI=1S/C21H26BrN3O6/c1-6-31-20(30)14(8-7-13(26)10-24-23)25-15(27)9-21(4,5)16-11(2)18(28)12(3)17(22)19(16)29/h10,14H,6-9H2,1-5H3,(H,25,27)/t14-/m0/s1 |
| InChIKey | ZOHFNXJSEYPWKC-AWEZNQCLSA-N |
| XLogP | 2.24 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|