C14H23N3O6S — CID 170532540
propan-2-yl (2S)-6-diazo-5-oxo-2-[(2-propan-2-ylsulfonylacetyl)amino]hexanoate (PubChem CID 170532540) has the molecular formula C14H23N3O6S and a molecular weight of 361.42 g/mol. Its IUPAC name is propan-2-yl (2S)-6-diazo-5-oxo-2-[(2-propan-2-ylsulfonylacetyl)amino]hexanoate.
| Compound Name | propan-2-yl (2S)-6-diazo-5-oxo-2-[(2-propan-2-ylsulfonylacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 170532540 |
| Molecular Formula | C14H23N3O6S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | propan-2-yl (2S)-6-diazo-5-oxo-2-[(2-propan-2-ylsulfonylacetyl)amino]hexanoate |
| SMILES | CC(C)OC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)CS(=O)(=O)C(C)C |
| InChI | InChI=1S/C14H23N3O6S/c1-9(2)23-14(20)12(6-5-11(18)7-16-15)17-13(19)8-24(21,22)10(3)4/h7,9-10,12H,5-6,8H2,1-4H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | VRCNYMQBGULNHO-LBPRGKRZSA-N |
| XLogP | -0.10 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|