C14H21F3N2O5 — CID 170445958
[(2S)-4,4,4-trifluorobutan-2-yl] (2S)-6-imino-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate (PubChem CID 170445958) has the molecular formula C14H21F3N2O5 and a molecular weight of 354.33 g/mol. Its IUPAC name is [(2S)-4,4,4-trifluorobutan-2-yl] (2S)-6-imino-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate.
| Compound Name | [(2S)-4,4,4-trifluorobutan-2-yl] (2S)-6-imino-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170445958 |
| Molecular Formula | C14H21F3N2O5 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [(2S)-4,4,4-trifluorobutan-2-yl] (2S)-6-imino-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](C)OC)C(=O)O[C@@H](C)CC(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O5/c1-8(6-14(15,16)17)24-13(22)11(5-4-10(20)7-18)19-12(21)9(2)23-3/h7-9,11,18H,4-6H2,1-3H3,(H,19,21)/b18-7+/t8-,9-,11-/m0/s1 |
| InChIKey | NLNFMXDSZCSINL-RPJZPITHSA-N |
| XLogP | 1.39 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|